C17H18ClFN2O4S — CID 54227555
2-methoxyethyl 2-chloro-4-fluoro-5-(1-hydroxy-3-sulfanylidene-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)benzoate (PubChem CID 54227555) has the molecular formula C17H18ClFN2O4S and a molecular weight of 400.86 g/mol. Its IUPAC name is 2-methoxyethyl 2-chloro-4-fluoro-5-(1-hydroxy-3-sulfanylidene-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)benzoate.
| Compound Name | 2-methoxyethyl 2-chloro-4-fluoro-5-(1-hydroxy-3-sulfanylidene-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)benzoate |
|---|---|
| PubChem CID | 54227555 |
| Molecular Formula | C17H18ClFN2O4S |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-methoxyethyl 2-chloro-4-fluoro-5-(1-hydroxy-3-sulfanylidene-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)benzoate |
| SMILES | COCCOC(=O)c1cc(-n2c(O)c3n(c2=S)CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C17H18ClFN2O4S/c1-24-6-7-25-16(23)10-8-14(12(19)9-11(10)18)21-15(22)13-4-2-3-5-20(13)17(21)26/h8-9,22H,2-7H2,1H3 |
| InChIKey | QGXYVTZMDAZJOQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|