C17H16Cl2FN3O6S — CID 170040758
[1-(2-chloroethoxy)-1-oxopropan-2-yl] 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate (PubChem CID 170040758) has the molecular formula C17H16Cl2FN3O6S and a molecular weight of 480.30 g/mol. Its IUPAC name is [1-(2-chloroethoxy)-1-oxopropan-2-yl] 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate.
| Compound Name | [1-(2-chloroethoxy)-1-oxopropan-2-yl] 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 170040758 |
| Molecular Formula | C17H16Cl2FN3O6S |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | [1-(2-chloroethoxy)-1-oxopropan-2-yl] 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate |
| SMILES | CC(OC(=O)c1cc(-n2c(=O)n(C)c(=S)n(C)c2=O)c(F)cc1Cl)C(=O)OCCCl |
| InChI | InChI=1S/C17H16Cl2FN3O6S/c1-8(13(24)28-5-4-18)29-14(25)9-6-12(11(20)7-10(9)19)23-15(26)21(2)17(30)22(3)16(23)27/h6-8H,4-5H2,1-3H3 |
| InChIKey | IKHGSHQRBADQCU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|