C18H22ClFN4O5S — CID 175547597
(butan-2-ylamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate (PubChem CID 175547597) has the molecular formula C18H22ClFN4O5S and a molecular weight of 460.92 g/mol. Its IUPAC name is (butan-2-ylamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate.
| Compound Name | (butan-2-ylamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate |
|---|---|
| PubChem CID | 175547597 |
| Molecular Formula | C18H22ClFN4O5S |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (butan-2-ylamino) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate |
| SMILES | CCC(C)NOC(=O)C(C)Oc1cc(-n2c(=O)n(C)c(=S)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C18H22ClFN4O5S/c1-6-9(2)21-29-15(25)10(3)28-14-8-13(12(20)7-11(14)19)24-16(26)22(4)18(30)23(5)17(24)27/h7-10,21H,6H2,1-5H3 |
| InChIKey | BDOXDDFJMQNLFK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|