C19H17ClF4N2O6 — CID 91362924
methyl 4-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-3-methoxypent-2-enoate (PubChem CID 91362924) has the molecular formula C19H17ClF4N2O6 and a molecular weight of 480.80 g/mol. Its IUPAC name is methyl 4-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-3-methoxypent-2-enoate.
| Compound Name | methyl 4-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-3-methoxypent-2-enoate |
|---|---|
| PubChem CID | 91362924 |
| Molecular Formula | C19H17ClF4N2O6 |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | methyl 4-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-3-methoxypent-2-enoate |
| SMILES | COC(=O)C=C(OC)C(C)Oc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C19H17ClF4N2O6/c1-9(13(30-3)7-17(28)31-4)32-14-6-12(11(21)5-10(14)20)26-16(27)8-15(19(22,23)24)25(2)18(26)29/h5-9H,1-4H3 |
| InChIKey | AQRRITMKPXDUOU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|