C20H20ClF4N3O7 — CID 87344183
methyl 3-[[3-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-2-oxobutoxy]amino]propanoate (PubChem CID 87344183) has the molecular formula C20H20ClF4N3O7 and a molecular weight of 525.84 g/mol. Its IUPAC name is methyl 3-[[3-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-2-oxobutoxy]amino]propanoate.
| Compound Name | methyl 3-[[3-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-2-oxobutoxy]amino]propanoate |
|---|---|
| PubChem CID | 87344183 |
| Molecular Formula | C20H20ClF4N3O7 |
| Molecular Weight | 525.84 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | methyl 3-[[3-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]-2-oxobutoxy]amino]propanoate |
| SMILES | COC(=O)CCNOCC(=O)C(C)Oc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C20H20ClF4N3O7/c1-10(14(29)9-34-26-5-4-18(31)33-3)35-15-7-13(12(22)6-11(15)21)28-17(30)8-16(20(23,24)25)27(2)19(28)32/h6-8,10,26H,4-5,9H2,1-3H3 |
| InChIKey | NNJQSWZCPAOIRO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.84 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|