C16H16ClFN4O6S — CID 175547621
(2-aminoacetyl) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate (PubChem CID 175547621) has the molecular formula C16H16ClFN4O6S and a molecular weight of 446.84 g/mol. Its IUPAC name is (2-aminoacetyl) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate.
| Compound Name | (2-aminoacetyl) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate |
|---|---|
| PubChem CID | 175547621 |
| Molecular Formula | C16H16ClFN4O6S |
| Molecular Weight | 446.84 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (2-aminoacetyl) 2-[2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenoxy]propanoate |
| SMILES | CC(Oc1cc(-n2c(=O)n(C)c(=S)n(C)c2=O)c(F)cc1Cl)C(=O)OC(=O)CN |
| InChI | InChI=1S/C16H16ClFN4O6S/c1-7(13(24)28-12(23)6-19)27-11-5-10(9(18)4-8(11)17)22-14(25)20(2)16(29)21(3)15(22)26/h4-5,7H,6,19H2,1-3H3 |
| InChIKey | PQPGRMDVCBSQMD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.84 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|