C9H9Cl2NO3 — CID 114929181
2-methoxyethyl 2,5-dichloropyridine-4-carboxylate (PubChem CID 114929181) has the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. Its IUPAC name is 2-methoxyethyl 2,5-dichloropyridine-4-carboxylate.
| Compound Name | 2-methoxyethyl 2,5-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 114929181 |
| Molecular Formula | C9H9Cl2NO3 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-methoxyethyl 2,5-dichloropyridine-4-carboxylate |
| SMILES | COCCOC(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C9H9Cl2NO3/c1-14-2-3-15-9(13)6-4-8(11)12-5-7(6)10/h4-5H,2-3H2,1H3 |
| InChIKey | QSKRWOSNDFPTGV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|