C14H8Cl2F4N2O3 — CID 21270749
ethyl 2-chloro-5-[2-chloro-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorobenzoate (PubChem CID 21270749) has the molecular formula C14H8Cl2F4N2O3 and a molecular weight of 399.13 g/mol. Its IUPAC name is ethyl 2-chloro-5-[2-chloro-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorobenzoate.
| Compound Name | ethyl 2-chloro-5-[2-chloro-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 21270749 |
| Molecular Formula | C14H8Cl2F4N2O3 |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | ethyl 2-chloro-5-[2-chloro-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(-n2c(Cl)nc(C(F)(F)F)cc2=O)c(F)cc1Cl |
| InChI | InChI=1S/C14H8Cl2F4N2O3/c1-2-25-12(24)6-3-9(8(17)4-7(6)15)22-11(23)5-10(14(18,19)20)21-13(22)16/h3-5H,2H2,1H3 |
| InChIKey | LWZWPZLOHBORMN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |