C18H15ClF6N2O3 — CID 21270796
propan-2-yl 2-chloro-5-[2-ethyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate (PubChem CID 21270796) has the molecular formula C18H15ClF6N2O3 and a molecular weight of 456.77 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-[2-ethyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate.
| Compound Name | propan-2-yl 2-chloro-5-[2-ethyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 21270796 |
| Molecular Formula | C18H15ClF6N2O3 |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | propan-2-yl 2-chloro-5-[2-ethyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate |
| SMILES | CCc1nc(C(F)(F)C(F)(F)F)cc(=O)n1-c1cc(C(=O)OC(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C18H15ClF6N2O3/c1-4-14-26-13(17(21,22)18(23,24)25)7-15(28)27(14)12-5-9(10(19)6-11(12)20)16(29)30-8(2)3/h5-8H,4H2,1-3H3 |
| InChIKey | AXJKJTQMONDCPD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|