C15H11ClF4N2O3 — CID 145266926
ethyl 2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoate (PubChem CID 145266926) has the molecular formula C15H11ClF4N2O3 and a molecular weight of 378.71 g/mol. Its IUPAC name is ethyl 2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoate.
| Compound Name | ethyl 2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoate |
|---|---|
| PubChem CID | 145266926 |
| Molecular Formula | C15H11ClF4N2O3 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | ethyl 2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2nn(C)c(C(F)(F)F)cc2=O)c(F)cc1Cl |
| InChI | InChI=1S/C15H11ClF4N2O3/c1-3-25-14(24)7-4-8(10(17)5-9(7)16)13-11(23)6-12(15(18,19)20)22(2)21-13/h4-6H,3H2,1-2H3 |
| InChIKey | JGSHHRMYESWXBG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |