C13H7ClF4N2O3 — CID 145267044
2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoic acid (PubChem CID 145267044) has the molecular formula C13H7ClF4N2O3 and a molecular weight of 350.66 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoic acid.
| Compound Name | 2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 145267044 |
| Molecular Formula | C13H7ClF4N2O3 |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2-chloro-4-fluoro-5-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]benzoic acid |
| SMILES | Cn1nc(-c2cc(C(=O)O)c(Cl)cc2F)c(=O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H7ClF4N2O3/c1-20-10(13(16,17)18)4-9(21)11(19-20)6-2-5(12(22)23)7(14)3-8(6)15/h2-4H,1H3,(H,22,23) |
| InChIKey | JTGOJURXIIHDJX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |