C13H10F4N2O2 — CID 145267088
3-(2-fluoro-4-methoxyphenyl)-1-methyl-6-(trifluoromethyl)pyridazin-4-one (PubChem CID 145267088) has the molecular formula C13H10F4N2O2 and a molecular weight of 302.23 g/mol. Its IUPAC name is 3-(2-fluoro-4-methoxyphenyl)-1-methyl-6-(trifluoromethyl)pyridazin-4-one.
| Compound Name | 3-(2-fluoro-4-methoxyphenyl)-1-methyl-6-(trifluoromethyl)pyridazin-4-one |
|---|---|
| PubChem CID | 145267088 |
| Molecular Formula | C13H10F4N2O2 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-(2-fluoro-4-methoxyphenyl)-1-methyl-6-(trifluoromethyl)pyridazin-4-one |
| SMILES | COc1ccc(-c2nn(C)c(C(F)(F)F)cc2=O)c(F)c1 |
| InChI | InChI=1S/C13H10F4N2O2/c1-19-11(13(15,16)17)6-10(20)12(18-19)8-4-3-7(21-2)5-9(8)14/h3-6H,1-2H3 |
| InChIKey | XPFWSDTUWPYOIV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |