C14H9ClF4N2O5 — CID 70409742
[2-chloro-5-[2-ethoxy-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorophenyl] hydrogen carbonate (PubChem CID 70409742) has the molecular formula C14H9ClF4N2O5 and a molecular weight of 396.68 g/mol. Its IUPAC name is [2-chloro-5-[2-ethoxy-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorophenyl] hydrogen carbonate.
| Compound Name | [2-chloro-5-[2-ethoxy-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorophenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 70409742 |
| Molecular Formula | C14H9ClF4N2O5 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | [2-chloro-5-[2-ethoxy-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-fluorophenyl] hydrogen carbonate |
| SMILES | CCOc1nc(C(F)(F)F)cc(=O)n1-c1cc(OC(=O)O)c(Cl)cc1F |
| InChI | InChI=1S/C14H9ClF4N2O5/c1-2-25-12-20-10(14(17,18)19)5-11(22)21(12)8-4-9(26-13(23)24)6(15)3-7(8)16/h3-5H,2H2,1H3,(H,23,24) |
| InChIKey | VRCWEMBKFPXPDW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|