C17H20ClFN2O5 — CID 15589898
ethyl 1-[(4-chloro-5-ethoxycarbonyl-2-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylate (PubChem CID 15589898) has the molecular formula C17H20ClFN2O5 and a molecular weight of 386.81 g/mol. Its IUPAC name is ethyl 1-[(4-chloro-5-ethoxycarbonyl-2-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[(4-chloro-5-ethoxycarbonyl-2-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15589898 |
| Molecular Formula | C17H20ClFN2O5 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | ethyl 1-[(4-chloro-5-ethoxycarbonyl-2-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)N2CCCC2C(=O)OCC)c(F)cc1Cl |
| InChI | InChI=1S/C17H20ClFN2O5/c1-3-25-15(22)10-8-13(12(19)9-11(10)18)20-17(24)21-7-5-6-14(21)16(23)26-4-2/h8-9,14H,3-7H2,1-2H3,(H,20,24) |
| InChIKey | RNESJDXYFJITBB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |