C13H14Cl2N2O3 — CID 114918292
ethyl 1-(2,5-dichloropyridine-4-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 114918292) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is ethyl 1-(2,5-dichloropyridine-4-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(2,5-dichloropyridine-4-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 114918292 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | ethyl 1-(2,5-dichloropyridine-4-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1C(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-2-20-13(19)10-4-3-5-17(10)12(18)8-6-11(15)16-7-9(8)14/h6-7,10H,2-5H2,1H3 |
| InChIKey | FTLFMYGFCFGVLQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|