C14H15ClN2O5 — CID 102353546
ethyl (2S)-1-(3-chloro-2-nitrobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 102353546) has the molecular formula C14H15ClN2O5 and a molecular weight of 326.74 g/mol. Its IUPAC name is ethyl (2S)-1-(3-chloro-2-nitrobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-(3-chloro-2-nitrobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102353546 |
| Molecular Formula | C14H15ClN2O5 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | ethyl (2S)-1-(3-chloro-2-nitrobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN1C(=O)c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15ClN2O5/c1-2-22-14(19)11-7-4-8-16(11)13(18)9-5-3-6-10(15)12(9)17(20)21/h3,5-6,11H,2,4,7-8H2,1H3/t11-/m0/s1 |
| InChIKey | UMSPZVBZCQOOIN-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|