C23H28N6O — CID 56737398
[4-[2-amino-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(4-tert-butylphenyl)methanone (PubChem CID 56737398) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is [4-[2-amino-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [4-[2-amino-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 56737398 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | [4-[2-amino-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-(4-tert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCN(c3ccc(-n4cnnc4)cc3N)CC2)cc1 |
| InChI | InChI=1S/C23H28N6O/c1-23(2,3)18-6-4-17(5-7-18)22(30)28-12-10-27(11-13-28)21-9-8-19(14-20(21)24)29-15-25-26-16-29/h4-9,14-16H,10-13,24H2,1-3H3 |
| InChIKey | YSJLJJJNUYDUBK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|