C27H37N5O2 — CID 23991156
[4-[2-amino-4-(piperazine-1-carbonyl)phenyl]-1,4-diazepan-1-yl]-(4-tert-butylphenyl)methanone (PubChem CID 23991156) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is [4-[2-amino-4-(piperazine-1-carbonyl)phenyl]-1,4-diazepan-1-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [4-[2-amino-4-(piperazine-1-carbonyl)phenyl]-1,4-diazepan-1-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 23991156 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | [4-[2-amino-4-(piperazine-1-carbonyl)phenyl]-1,4-diazepan-1-yl]-(4-tert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCCN(c3ccc(C(=O)N4CCNCC4)cc3N)CC2)cc1 |
| InChI | InChI=1S/C27H37N5O2/c1-27(2,3)22-8-5-20(6-9-22)25(33)31-14-4-13-30(17-18-31)24-10-7-21(19-23(24)28)26(34)32-15-11-29-12-16-32/h5-10,19,29H,4,11-18,28H2,1-3H3 |
| InChIKey | LWOFHAUKKSPHHD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|