C24H29Cl2N5O2 — CID 23878935
[3-amino-4-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone (PubChem CID 23878935) has the molecular formula C24H29Cl2N5O2 and a molecular weight of 490.44 g/mol. Its IUPAC name is [3-amino-4-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone.
| Compound Name | [3-amino-4-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 23878935 |
| Molecular Formula | C24H29Cl2N5O2 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [3-amino-4-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone |
| SMILES | Nc1cc(C(=O)N2CCCNCC2)ccc1N1CCCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C24H29Cl2N5O2/c25-18-4-5-19(20(26)16-18)24(33)31-11-2-10-29(13-14-31)22-6-3-17(15-21(22)27)23(32)30-9-1-7-28-8-12-30/h3-6,15-16,28H,1-2,7-14,27H2 |
| InChIKey | AZCLRFQDXYVSPO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|