C19H27N5O5 — CID 23877301
methyl 4-[4-(1,4-diazepane-1-carbonyl)-2-nitrophenyl]-1,4-diazepane-1-carboxylate (PubChem CID 23877301) has the molecular formula C19H27N5O5 and a molecular weight of 405.46 g/mol. Its IUPAC name is methyl 4-[4-(1,4-diazepane-1-carbonyl)-2-nitrophenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | methyl 4-[4-(1,4-diazepane-1-carbonyl)-2-nitrophenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 23877301 |
| Molecular Formula | C19H27N5O5 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | methyl 4-[4-(1,4-diazepane-1-carbonyl)-2-nitrophenyl]-1,4-diazepane-1-carboxylate |
| SMILES | COC(=O)N1CCCN(c2ccc(C(=O)N3CCCNCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H27N5O5/c1-29-19(26)23-10-3-9-21(12-13-23)16-5-4-15(14-17(16)24(27)28)18(25)22-8-2-6-20-7-11-22/h4-5,14,20H,2-3,6-13H2,1H3 |
| InChIKey | BVDBIZLLSRLDIB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|