C20H24N4O2 — CID 56738764
7-methyl-3-(quinoline-8-carbonyl)-3,7,11-triazaspiro[5.6]dodecan-12-one (PubChem CID 56738764) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 7-methyl-3-(quinoline-8-carbonyl)-3,7,11-triazaspiro[5.6]dodecan-12-one.
| Compound Name | 7-methyl-3-(quinoline-8-carbonyl)-3,7,11-triazaspiro[5.6]dodecan-12-one |
|---|---|
| PubChem CID | 56738764 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 7-methyl-3-(quinoline-8-carbonyl)-3,7,11-triazaspiro[5.6]dodecan-12-one |
| SMILES | CN1CCCNC(=O)C12CCN(C(=O)c1cccc3cccnc13)CC2 |
| InChI | InChI=1S/C20H24N4O2/c1-23-12-4-11-22-19(26)20(23)8-13-24(14-9-20)18(25)16-7-2-5-15-6-3-10-21-17(15)16/h2-3,5-7,10H,4,8-9,11-14H2,1H3,(H,22,26) |
| InChIKey | PHPRJFPMNNQSHE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |