About 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol
1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol (PubChem CID 56739174) has the molecular formula C24H28N2O
and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol |
| PubChem CID | 56739174 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol |
| SMILES | Cc1ccc2cc(C3(O)CCN(Cc4c(C)cccc4C)CC3)ccc2n1 |
| InChI | InChI=1S/C24H28N2O/c1-17-5-4-6-18(2)22(17)16-26-13-11-24(27,12-14-26)21-9-10-23-20(15-21)8-7-19(3)25-23/h4-10,15,27H,11-14,16H2,1-3H3 |
| InChIKey | OOJWUIQAFXTUAS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol?
The IUPAC name of 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol (CID 56739174) is 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol.
What is the SMILES notation for 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol?
The canonical SMILES for 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol is Cc1ccc2cc(C3(O)CCN(Cc4c(C)cccc4C)CC3)ccc2n1.
What is the InChIKey of 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol?
The InChIKey is OOJWUIQAFXTUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O/c1-17-5-4-6-18(2)22(17)16-26-13-11-24(27,12-14-26)21-9-10-23-20(15-21)8-7-19(3)25-23/h4-10,15,27H,11-14,16H2,1-3H3.
What are the key properties of 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol?
1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol has a molecular weight of 360.50 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-dimethylphenyl)methyl]-4-(2-methylquinolin-6-yl)piperidin-4-ol is sourced from PubChem (CID 56739174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).