C18H20N6O2 — CID 56745798
1-[4-hydroxy-4-(2-methylquinolin-6-yl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 56745798) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-[4-hydroxy-4-(2-methylquinolin-6-yl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[4-hydroxy-4-(2-methylquinolin-6-yl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 56745798 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[4-hydroxy-4-(2-methylquinolin-6-yl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | Cc1ccc2cc(C3(O)CCN(C(=O)Cn4cnnn4)CC3)ccc2n1 |
| InChI | InChI=1S/C18H20N6O2/c1-13-2-3-14-10-15(4-5-16(14)20-13)18(26)6-8-23(9-7-18)17(25)11-24-12-19-21-22-24/h2-5,10,12,26H,6-9,11H2,1H3 |
| InChIKey | RRZAAFNXNKEDRK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |