C15H26N2O2 — CID 56740911
2-(2,2-dimethyloxan-4-yl)-1-(3-ethoxypropyl)imidazole (PubChem CID 56740911) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-(2,2-dimethyloxan-4-yl)-1-(3-ethoxypropyl)imidazole.
| Compound Name | 2-(2,2-dimethyloxan-4-yl)-1-(3-ethoxypropyl)imidazole |
|---|---|
| PubChem CID | 56740911 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-(2,2-dimethyloxan-4-yl)-1-(3-ethoxypropyl)imidazole |
| SMILES | CCOCCCn1ccnc1C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C15H26N2O2/c1-4-18-10-5-8-17-9-7-16-14(17)13-6-11-19-15(2,3)12-13/h7,9,13H,4-6,8,10-12H2,1-3H3 |
| InChIKey | YBOTXZHYWMRMEF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|