C18H24N4O3S — CID 56741070
N-[2-[4-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 56741070) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[2-[4-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 56741070 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[2-[4-[4-(2-methylphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | Cc1ccccc1-c1cn[nH]c1C1CCN(C(=O)CNS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H24N4O3S/c1-13-5-3-4-6-15(13)16-11-19-21-18(16)14-7-9-22(10-8-14)17(23)12-20-26(2,24)25/h3-6,11,14,20H,7-10,12H2,1-2H3,(H,19,21) |
| InChIKey | HKRRJMMIGVFCJC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |