C23H30N4O — CID 56743397
(E)-N-[[2-[4-(2-methylphenyl)piperazin-1-yl]-3-pyridinyl]methyl]hex-3-enamide (PubChem CID 56743397) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is (E)-N-[[2-[4-(2-methylphenyl)piperazin-1-yl]-3-pyridinyl]methyl]hex-3-enamide.
| Compound Name | (E)-N-[[2-[4-(2-methylphenyl)piperazin-1-yl]-3-pyridinyl]methyl]hex-3-enamide |
|---|---|
| PubChem CID | 56743397 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (E)-N-[[2-[4-(2-methylphenyl)piperazin-1-yl]-3-pyridinyl]methyl]hex-3-enamide |
| SMILES | CC/C=C/CC(=O)NCc1cccnc1N1CCN(c2ccccc2C)CC1 |
| InChI | InChI=1S/C23H30N4O/c1-3-4-5-12-22(28)25-18-20-10-8-13-24-23(20)27-16-14-26(15-17-27)21-11-7-6-9-19(21)2/h4-11,13H,3,12,14-18H2,1-2H3,(H,25,28)/b5-4+ |
| InChIKey | LSSKHIHPWXFZGZ-SNAWJCMRSA-N |
| XLogP | 3.69 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|