C19H22ClNO3 — CID 56743545
7-(3-chlorophenyl)-4-(2-ethoxyethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol (PubChem CID 56743545) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-4-(2-ethoxyethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol.
| Compound Name | 7-(3-chlorophenyl)-4-(2-ethoxyethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
|---|---|
| PubChem CID | 56743545 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 7-(3-chlorophenyl)-4-(2-ethoxyethyl)-3,5-dihydro-2H-1,4-benzoxazepin-9-ol |
| SMILES | CCOCCN1CCOc2c(O)cc(-c3cccc(Cl)c3)cc2C1 |
| InChI | InChI=1S/C19H22ClNO3/c1-2-23-8-6-21-7-9-24-19-16(13-21)10-15(12-18(19)22)14-4-3-5-17(20)11-14/h3-5,10-12,22H,2,6-9,13H2,1H3 |
| InChIKey | QNAMRORMSBEWIS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|