C21H24ClNO4 — CID 56751525
methyl 5-[7-(3-chlorophenyl)-9-hydroxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pentanoate (PubChem CID 56751525) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is methyl 5-[7-(3-chlorophenyl)-9-hydroxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pentanoate.
| Compound Name | methyl 5-[7-(3-chlorophenyl)-9-hydroxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pentanoate |
|---|---|
| PubChem CID | 56751525 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 5-[7-(3-chlorophenyl)-9-hydroxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pentanoate |
| SMILES | COC(=O)CCCCN1CCOc2c(O)cc(-c3cccc(Cl)c3)cc2C1 |
| InChI | InChI=1S/C21H24ClNO4/c1-26-20(25)7-2-3-8-23-9-10-27-21-17(14-23)11-16(13-19(21)24)15-5-4-6-18(22)12-15/h4-6,11-13,24H,2-3,7-10,14H2,1H3 |
| InChIKey | GLTSTIWIKMMFNO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|