C20H36N6O3 — CID 56743647
[3-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]-3-oxopropyl]urea (PubChem CID 56743647) has the molecular formula C20H36N6O3 and a molecular weight of 408.55 g/mol. Its IUPAC name is [3-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]-3-oxopropyl]urea.
| Compound Name | [3-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]-3-oxopropyl]urea |
|---|---|
| PubChem CID | 56743647 |
| Molecular Formula | C20H36N6O3 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | [3-[4-[3-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]-3-oxopropyl]urea |
| SMILES | CN1CCN(C(=O)C2CCCN(C3CCN(C(=O)CCNC(N)=O)CC3)C2)CC1 |
| InChI | InChI=1S/C20H36N6O3/c1-23-11-13-25(14-12-23)19(28)16-3-2-8-26(15-16)17-5-9-24(10-6-17)18(27)4-7-22-20(21)29/h16-17H,2-15H2,1H3,(H3,21,22,29) |
| InChIKey | KVECEJRRIYCCCE-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |