C21H41N5O3S — CID 3563959
1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 3563959) has the molecular formula C21H41N5O3S and a molecular weight of 443.66 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3563959 |
| Molecular Formula | C21H41N5O3S |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)N2CCCC(C(=O)NCCCN3CCN(C)CC3)C2)C1 |
| InChI | InChI=1S/C21H41N5O3S/c1-18-14-19(2)16-26(15-18)30(28,29)25-9-4-6-20(17-25)21(27)22-7-5-8-24-12-10-23(3)11-13-24/h18-20H,4-17H2,1-3H3,(H,22,27) |
| InChIKey | FHUKVDHZWUGGFA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|