C20H19N3O3 — CID 56743775
2-amino-4-[5-(hydroxymethyl)furan-2-yl]-6-(3-propan-2-yloxyphenyl)pyridine-3-carbonitrile (PubChem CID 56743775) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-amino-4-[5-(hydroxymethyl)furan-2-yl]-6-(3-propan-2-yloxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[5-(hydroxymethyl)furan-2-yl]-6-(3-propan-2-yloxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56743775 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-amino-4-[5-(hydroxymethyl)furan-2-yl]-6-(3-propan-2-yloxyphenyl)pyridine-3-carbonitrile |
| SMILES | CC(C)Oc1cccc(-c2cc(-c3ccc(CO)o3)c(C#N)c(N)n2)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-12(2)25-14-5-3-4-13(8-14)18-9-16(17(10-21)20(22)23-18)19-7-6-15(11-24)26-19/h3-9,12,24H,11H2,1-2H3,(H2,22,23) |
| InChIKey | OXAQJXFWBMSOLT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |