C17H29N5O2 — CID 56744490
N-[2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]pyrazol-3-yl]-3-methylbutanamide (PubChem CID 56744490) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]pyrazol-3-yl]-3-methylbutanamide.
| Compound Name | N-[2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]pyrazol-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 56744490 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | N-[2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]pyrazol-3-yl]-3-methylbutanamide |
| SMILES | CC[C@H](N)C(=O)N1CCC(n2nccc2NC(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C17H29N5O2/c1-4-14(18)17(24)21-9-6-13(7-10-21)22-15(5-8-19-22)20-16(23)11-12(2)3/h5,8,12-14H,4,6-7,9-11,18H2,1-3H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | AKDCYOWEYGNIFE-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |