C17H30N4OS — CID 25453298
3-methyl-N-[2-[1-[(2R)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]pyrazol-3-yl]butanamide (PubChem CID 25453298) has the molecular formula C17H30N4OS and a molecular weight of 338.52 g/mol. Its IUPAC name is 3-methyl-N-[2-[1-[(2R)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]pyrazol-3-yl]butanamide.
| Compound Name | 3-methyl-N-[2-[1-[(2R)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]pyrazol-3-yl]butanamide |
|---|---|
| PubChem CID | 25453298 |
| Molecular Formula | C17H30N4OS |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-methyl-N-[2-[1-[(2R)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]pyrazol-3-yl]butanamide |
| SMILES | CSC[C@@H](C)N1CCC(n2nccc2NC(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C17H30N4OS/c1-13(2)11-17(22)19-16-5-8-18-21(16)15-6-9-20(10-7-15)14(3)12-23-4/h5,8,13-15H,6-7,9-12H2,1-4H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | GMDSBMSRXJSGPW-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |