C18H30N4O3 — CID 154914576
N-(2-cyclopentylpyrazol-3-yl)-3-piperidin-1-ylbutanamide;formic acid (PubChem CID 154914576) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-3-piperidin-1-ylbutanamide;formic acid.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-3-piperidin-1-ylbutanamide;formic acid |
|---|---|
| PubChem CID | 154914576 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-3-piperidin-1-ylbutanamide;formic acid |
| SMILES | CC(CC(=O)Nc1ccnn1C1CCCC1)N1CCCCC1.O=CO |
| InChI | InChI=1S/C17H28N4O.CH2O2/c1-14(20-11-5-2-6-12-20)13-17(22)19-16-9-10-18-21(16)15-7-3-4-8-15;2-1-3/h9-10,14-15H,2-8,11-13H2,1H3,(H,19,22);1H,(H,2,3) |
| InChIKey | VHVHWQWJIZIFHG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|