C23H24N6O — CID 56744991
2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methylamino]pyridine-4-carbonitrile (PubChem CID 56744991) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methylamino]pyridine-4-carbonitrile.
| Compound Name | 2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 56744991 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methylamino]pyridine-4-carbonitrile |
| SMILES | COc1ccccc1N1CCN(c2ncccc2CNc2cc(C#N)ccn2)CC1 |
| InChI | InChI=1S/C23H24N6O/c1-30-21-7-3-2-6-20(21)28-11-13-29(14-12-28)23-19(5-4-9-26-23)17-27-22-15-18(16-24)8-10-25-22/h2-10,15H,11-14,17H2,1H3,(H,25,27) |
| InChIKey | YEZMAAZXJQZSBH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |