C20H26N4O3S — CID 42458057
N-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methyl]prop-2-ene-1-sulfonamide (PubChem CID 42458057) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methyl]prop-2-ene-1-sulfonamide.
| Compound Name | N-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methyl]prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 42458057 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[[2-[4-(2-methoxyphenyl)piperazin-1-yl]-3-pyridinyl]methyl]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)NCc1cccnc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-3-15-28(25,26)22-16-17-7-6-10-21-20(17)24-13-11-23(12-14-24)18-8-4-5-9-19(18)27-2/h3-10,22H,1,11-16H2,2H3 |
| InChIKey | GRAHFHBOCDIFFH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|