C19H21FN4O4 — CID 56746568
2-[2-[(3-fluorophenoxy)methyl]-1,3-oxazole-4-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 56746568) has the molecular formula C19H21FN4O4 and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[2-[(3-fluorophenoxy)methyl]-1,3-oxazole-4-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 2-[2-[(3-fluorophenoxy)methyl]-1,3-oxazole-4-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 56746568 |
| Molecular Formula | C19H21FN4O4 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[2-[(3-fluorophenoxy)methyl]-1,3-oxazole-4-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(C(=O)c3coc(COc4cccc(F)c4)n3)CC2C1=O |
| InChI | InChI=1S/C19H21FN4O4/c1-22-5-6-23-7-8-24(10-16(23)19(22)26)18(25)15-11-28-17(21-15)12-27-14-4-2-3-13(20)9-14/h2-4,9,11,16H,5-8,10,12H2,1H3 |
| InChIKey | DHRKZZBAUUJMNT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |