C19H23FN4O4 — CID 110085731
N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-methyl-1,3-oxazole-4-carbonyl)piperazine-2-carboxamide (PubChem CID 110085731) has the molecular formula C19H23FN4O4 and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-methyl-1,3-oxazole-4-carbonyl)piperazine-2-carboxamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-methyl-1,3-oxazole-4-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 110085731 |
| Molecular Formula | C19H23FN4O4 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-methyl-1,3-oxazole-4-carbonyl)piperazine-2-carboxamide |
| SMILES | Cc1nc(C(=O)N2CCN(C)C(C(=O)NCCOc3cccc(F)c3)C2)co1 |
| InChI | InChI=1S/C19H23FN4O4/c1-13-22-16(12-28-13)19(26)24-8-7-23(2)17(11-24)18(25)21-6-9-27-15-5-3-4-14(20)10-15/h3-5,10,12,17H,6-9,11H2,1-2H3,(H,21,25) |
| InChIKey | STNUSAKXHNLGIB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|