C18H22FN5O4 — CID 124968589
(2S)-N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide (PubChem CID 124968589) has the molecular formula C18H22FN5O4 and a molecular weight of 391.40 g/mol. Its IUPAC name is (2S)-N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide.
| Compound Name | (2S)-N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124968589 |
| Molecular Formula | C18H22FN5O4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2S)-N-[2-(3-fluorophenoxy)ethyl]-1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide |
| SMILES | CN1CCN(C(=O)c2c[nH]c(=O)[nH]2)C[C@H]1C(=O)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C18H22FN5O4/c1-23-6-7-24(17(26)14-10-21-18(27)22-14)11-15(23)16(25)20-5-8-28-13-4-2-3-12(19)9-13/h2-4,9-10,15H,5-8,11H2,1H3,(H,20,25)(H2,21,22,27)/t15-/m0/s1 |
| InChIKey | JCFHKRZHEPJLJK-HNNXBMFYSA-N |
| XLogP | -0.21 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|