C19H25N5O4 — CID 125021648
(2S)-1-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide (PubChem CID 125021648) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2S)-1-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide.
| Compound Name | (2S)-1-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 125021648 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2S)-1-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)piperazine-2-carboxamide |
| SMILES | Cc1ccccc1OCCNC(=O)[C@@H]1CN(C(=O)c2c[nH]c(=O)[nH]2)CCN1C |
| InChI | InChI=1S/C19H25N5O4/c1-13-5-3-4-6-16(13)28-10-7-20-17(25)15-12-24(9-8-23(15)2)18(26)14-11-21-19(27)22-14/h3-6,11,15H,7-10,12H2,1-2H3,(H,20,25)(H2,21,22,27)/t15-/m0/s1 |
| InChIKey | YLJGSWMQSNZQQF-HNNXBMFYSA-N |
| XLogP | -0.04 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|