C21H26N6O3 — CID 110085675
1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)-N-(1,2,3-trimethylindol-5-yl)piperazine-2-carboxamide (PubChem CID 110085675) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)-N-(1,2,3-trimethylindol-5-yl)piperazine-2-carboxamide.
| Compound Name | 1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)-N-(1,2,3-trimethylindol-5-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 110085675 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-methyl-4-(2-oxo-1,3-dihydroimidazole-4-carbonyl)-N-(1,2,3-trimethylindol-5-yl)piperazine-2-carboxamide |
| SMILES | Cc1c(C)n(C)c2ccc(NC(=O)C3CN(C(=O)c4c[nH]c(=O)[nH]4)CCN3C)cc12 |
| InChI | InChI=1S/C21H26N6O3/c1-12-13(2)26(4)17-6-5-14(9-15(12)17)23-19(28)18-11-27(8-7-25(18)3)20(29)16-10-22-21(30)24-16/h5-6,9-10,18H,7-8,11H2,1-4H3,(H,23,28)(H2,22,24,30) |
| InChIKey | JGPIGMQJAMTWKC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|