C22H31N5O3 — CID 124966205
(2S)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-(1-ethylpyrazole-3-carbonyl)-1-methylpiperazine-2-carboxamide (PubChem CID 124966205) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2S)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-(1-ethylpyrazole-3-carbonyl)-1-methylpiperazine-2-carboxamide.
| Compound Name | (2S)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-(1-ethylpyrazole-3-carbonyl)-1-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 124966205 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (2S)-N-[2-(2,4-dimethylphenoxy)ethyl]-4-(1-ethylpyrazole-3-carbonyl)-1-methylpiperazine-2-carboxamide |
| SMILES | CCn1ccc(C(=O)N2CCN(C)[C@H](C(=O)NCCOc3ccc(C)cc3C)C2)n1 |
| InChI | InChI=1S/C22H31N5O3/c1-5-27-10-8-18(24-27)22(29)26-12-11-25(4)19(15-26)21(28)23-9-13-30-20-7-6-16(2)14-17(20)3/h6-8,10,14,19H,5,9,11-13,15H2,1-4H3,(H,23,28)/t19-/m0/s1 |
| InChIKey | IKFAUUPCZIKQLO-IBGZPJMESA-N |
| XLogP | 1.47 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|