C21H27N5O4 — CID 124941001
(2S)-1-methyl-4-(1-methyl-6-oxopyridazine-3-carbonyl)-N-[2-(2-methylphenoxy)ethyl]piperazine-2-carboxamide (PubChem CID 124941001) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is (2S)-1-methyl-4-(1-methyl-6-oxopyridazine-3-carbonyl)-N-[2-(2-methylphenoxy)ethyl]piperazine-2-carboxamide.
| Compound Name | (2S)-1-methyl-4-(1-methyl-6-oxopyridazine-3-carbonyl)-N-[2-(2-methylphenoxy)ethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124941001 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2S)-1-methyl-4-(1-methyl-6-oxopyridazine-3-carbonyl)-N-[2-(2-methylphenoxy)ethyl]piperazine-2-carboxamide |
| SMILES | Cc1ccccc1OCCNC(=O)[C@@H]1CN(C(=O)c2ccc(=O)n(C)n2)CCN1C |
| InChI | InChI=1S/C21H27N5O4/c1-15-6-4-5-7-18(15)30-13-10-22-20(28)17-14-26(12-11-24(17)2)21(29)16-8-9-19(27)25(3)23-16/h4-9,17H,10-14H2,1-3H3,(H,22,28)/t17-/m0/s1 |
| InChIKey | AKFKSTNXYZETAB-KRWDZBQOSA-N |
| XLogP | 0.04 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|