C18H24N2O3S — CID 56747250
N-[[1-[(3-methyl-1-benzofuran-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclopropanesulfonamide (PubChem CID 56747250) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[[1-[(3-methyl-1-benzofuran-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclopropanesulfonamide.
| Compound Name | N-[[1-[(3-methyl-1-benzofuran-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 56747250 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[[1-[(3-methyl-1-benzofuran-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclopropanesulfonamide |
| SMILES | Cc1c(CN2CCC(CNS(=O)(=O)C3CC3)C2)oc2ccccc12 |
| InChI | InChI=1S/C18H24N2O3S/c1-13-16-4-2-3-5-17(16)23-18(13)12-20-9-8-14(11-20)10-19-24(21,22)15-6-7-15/h2-5,14-15,19H,6-12H2,1H3 |
| InChIKey | KSUQOTPEMVSCAB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |