C18H23N7S — CID 56749262
2-N,2-N,4-N-trimethyl-4-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine (PubChem CID 56749262) has the molecular formula C18H23N7S and a molecular weight of 369.50 g/mol. Its IUPAC name is 2-N,2-N,4-N-trimethyl-4-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-trimethyl-4-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 56749262 |
| Molecular Formula | C18H23N7S |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-N,2-N,4-N-trimethyl-4-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc2c(c(N(C)Cc3cc(-c4cccs4)n[nH]3)n1)CCNC2 |
| InChI | InChI=1S/C18H23N7S/c1-24(2)18-20-15-10-19-7-6-13(15)17(21-18)25(3)11-12-9-14(23-22-12)16-5-4-8-26-16/h4-5,8-9,19H,6-7,10-11H2,1-3H3,(H,22,23) |
| InChIKey | NNFOXJGTRICZCT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |