C9H7N3S — CID 14911014
2-(3-thiophen-2-yl-1H-pyrazol-5-yl)acetonitrile (PubChem CID 14911014) has the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 2-(3-thiophen-2-yl-1H-pyrazol-5-yl)acetonitrile.
| Compound Name | 2-(3-thiophen-2-yl-1H-pyrazol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 14911014 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-(3-thiophen-2-yl-1H-pyrazol-5-yl)acetonitrile |
| SMILES | N#CCc1cc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C9H7N3S/c10-4-3-7-6-8(12-11-7)9-2-1-5-13-9/h1-2,5-6H,3H2,(H,11,12) |
| InChIKey | GFSDRRGYUVUTHD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |