C10H10N2O2S — CID 175261379
2-(3-thiophen-2-yl-1H-pyrazol-5-yl)ethyl formate (PubChem CID 175261379) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(3-thiophen-2-yl-1H-pyrazol-5-yl)ethyl formate.
| Compound Name | 2-(3-thiophen-2-yl-1H-pyrazol-5-yl)ethyl formate |
|---|---|
| PubChem CID | 175261379 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-(3-thiophen-2-yl-1H-pyrazol-5-yl)ethyl formate |
| SMILES | O=COCCc1cc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C10H10N2O2S/c13-7-14-4-3-8-6-9(12-11-8)10-2-1-5-15-10/h1-2,5-7H,3-4H2,(H,11,12) |
| InChIKey | KJBDQCHBQYJXFI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|