C10H11N3OS — CID 82446483
5-(methylaminomethyl)-3-thiophen-2-yl-1H-pyridazin-6-one (PubChem CID 82446483) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 5-(methylaminomethyl)-3-thiophen-2-yl-1H-pyridazin-6-one.
| Compound Name | 5-(methylaminomethyl)-3-thiophen-2-yl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 82446483 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 5-(methylaminomethyl)-3-thiophen-2-yl-1H-pyridazin-6-one |
| SMILES | CNCc1cc(-c2cccs2)n[nH]c1=O |
| InChI | InChI=1S/C10H11N3OS/c1-11-6-7-5-8(12-13-10(7)14)9-3-2-4-15-9/h2-5,11H,6H2,1H3,(H,13,14) |
| InChIKey | WWYNWQNXDNQHGI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |