C16H21N5S — CID 19627694
1-(1-ethyl-5-methylpyrazol-4-yl)-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]ethanamine (PubChem CID 19627694) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is 1-(1-ethyl-5-methylpyrazol-4-yl)-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]ethanamine.
| Compound Name | 1-(1-ethyl-5-methylpyrazol-4-yl)-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 19627694 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(1-ethyl-5-methylpyrazol-4-yl)-N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]ethanamine |
| SMILES | CCn1ncc(C(C)NCc2cc(-c3cccs3)n[nH]2)c1C |
| InChI | InChI=1S/C16H21N5S/c1-4-21-12(3)14(10-18-21)11(2)17-9-13-8-15(20-19-13)16-6-5-7-22-16/h5-8,10-11,17H,4,9H2,1-3H3,(H,19,20) |
| InChIKey | OZIUTVZEVBHPNO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |