C13H20N6 — CID 56750244
5-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-ethylpyrimidin-2-amine (PubChem CID 56750244) has the molecular formula C13H20N6 and a molecular weight of 260.35 g/mol. Its IUPAC name is 5-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-ethylpyrimidin-2-amine.
| Compound Name | 5-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 56750244 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 5-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(-c2nccn2CCN(C)C)cn1 |
| InChI | InChI=1S/C13H20N6/c1-4-14-13-16-9-11(10-17-13)12-15-5-6-19(12)8-7-18(2)3/h5-6,9-10H,4,7-8H2,1-3H3,(H,14,16,17) |
| InChIKey | SHQKYQCEDFTIHF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |